C23H19FN4O2 — CID 135237762
N-[3-[3-(2-fluoro-4-pyridinyl)-4-methyl-1H-pyrrolo[2,3-b]pyridin-5-yl]-5-methoxyphenyl]prop-2-enamide (PubChem CID 135237762) has the molecular formula C23H19FN4O2 and a molecular weight of 402.43 g/mol. Its IUPAC name is N-[3-[3-(2-fluoro-4-pyridinyl)-4-methyl-1H-pyrrolo[2,3-b]pyridin-5-yl]-5-methoxyphenyl]prop-2-enamide.
| Compound Name | N-[3-[3-(2-fluoro-4-pyridinyl)-4-methyl-1H-pyrrolo[2,3-b]pyridin-5-yl]-5-methoxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 135237762 |
| Molecular Formula | C23H19FN4O2 |
| Molecular Weight | 402.43 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | N-[3-[3-(2-fluoro-4-pyridinyl)-4-methyl-1H-pyrrolo[2,3-b]pyridin-5-yl]-5-methoxyphenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(OC)cc(-c2cnc3[nH]cc(-c4ccnc(F)c4)c3c2C)c1 |
| InChI | InChI=1S/C23H19FN4O2/c1-4-21(29)28-16-7-15(8-17(10-16)30-3)18-11-26-23-22(13(18)2)19(12-27-23)14-5-6-25-20(24)9-14/h4-12H,1H2,2-3H3,(H,26,27)(H,28,29) |
| InChIKey | CIOISRISHFMLNA-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.43 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|