C19H18F9NO4 — CID 135238381
1,1,1,3,3,3-hexafluoropropan-2-yl 3-[3-(trifluoromethoxy)phenyl]-1-oxa-8-azaspiro[4.5]decane-8-carboxylate (PubChem CID 135238381) has the molecular formula C19H18F9NO4 and a molecular weight of 495.34 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 3-[3-(trifluoromethoxy)phenyl]-1-oxa-8-azaspiro[4.5]decane-8-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 3-[3-(trifluoromethoxy)phenyl]-1-oxa-8-azaspiro[4.5]decane-8-carboxylate |
|---|---|
| PubChem CID | 135238381 |
| Molecular Formula | C19H18F9NO4 |
| Molecular Weight | 495.34 g/mol |
| Exact Mass | 495.11 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 3-[3-(trifluoromethoxy)phenyl]-1-oxa-8-azaspiro[4.5]decane-8-carboxylate |
| SMILES | O=C(OC(C(F)(F)F)C(F)(F)F)N1CCC2(CC1)CC(c1cccc(OC(F)(F)F)c1)CO2 |
| InChI | InChI=1S/C19H18F9NO4/c20-17(21,22)14(18(23,24)25)32-15(30)29-6-4-16(5-7-29)9-12(10-31-16)11-2-1-3-13(8-11)33-19(26,27)28/h1-3,8,12,14H,4-7,9-10H2 |
| InChIKey | OVKLDGVHWSSHGP-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.34 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |