C19H13BrFN3O2S — CID 135238468
5-bromo-3-(2-fluoro-4-pyridinyl)-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine (PubChem CID 135238468) has the molecular formula C19H13BrFN3O2S and a molecular weight of 446.30 g/mol. Its IUPAC name is 5-bromo-3-(2-fluoro-4-pyridinyl)-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine.
| Compound Name | 5-bromo-3-(2-fluoro-4-pyridinyl)-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 135238468 |
| Molecular Formula | C19H13BrFN3O2S |
| Molecular Weight | 446.30 g/mol |
| Exact Mass | 444.99 |
| IUPAC Name | 5-bromo-3-(2-fluoro-4-pyridinyl)-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine |
| SMILES | Cc1ccc(S(=O)(=O)n2cc(-c3ccnc(F)c3)c3cc(Br)cnc32)cc1 |
| InChI | InChI=1S/C19H13BrFN3O2S/c1-12-2-4-15(5-3-12)27(25,26)24-11-17(13-6-7-22-18(21)8-13)16-9-14(20)10-23-19(16)24/h2-11H,1H3 |
| InChIKey | MMYVJQUYJUCKAY-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.30 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|