C19H20F9N3O3 — CID 135238514
1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[6-(trifluoromethyl)-3-pyridinyl]methyl]-1-oxa-4,9-diazaspiro[5.5]undecane-9-carboxylate (PubChem CID 135238514) has the molecular formula C19H20F9N3O3 and a molecular weight of 509.37 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[6-(trifluoromethyl)-3-pyridinyl]methyl]-1-oxa-4,9-diazaspiro[5.5]undecane-9-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[6-(trifluoromethyl)-3-pyridinyl]methyl]-1-oxa-4,9-diazaspiro[5.5]undecane-9-carboxylate |
|---|---|
| PubChem CID | 135238514 |
| Molecular Formula | C19H20F9N3O3 |
| Molecular Weight | 509.37 g/mol |
| Exact Mass | 509.14 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[6-(trifluoromethyl)-3-pyridinyl]methyl]-1-oxa-4,9-diazaspiro[5.5]undecane-9-carboxylate |
| SMILES | O=C(OC(C(F)(F)F)C(F)(F)F)N1CCC2(CC1)CN(Cc1ccc(C(F)(F)F)nc1)CCO2 |
| InChI | InChI=1S/C19H20F9N3O3/c20-17(21,22)13-2-1-12(9-29-13)10-30-7-8-33-16(11-30)3-5-31(6-4-16)15(32)34-14(18(23,24)25)19(26,27)28/h1-2,9,14H,3-8,10-11H2 |
| InChIKey | VQTJQLXWOZKSRE-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.37 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |