C36H54N4O8 — CID 135239463
(2S)-3-(4-hydroxyphenyl)-2-[[2-[[(2S)-1-[(2S)-1-(3-oxo-2-propyldodecanoyl)pyrrolidine-2-carbonyl]pyrrolidine-2-carbonyl]amino]acetyl]amino]propanoic acid (PubChem CID 135239463) has the molecular formula C36H54N4O8 and a molecular weight of 670.85 g/mol. Its IUPAC name is (2S)-3-(4-hydroxyphenyl)-2-[[2-[[(2S)-1-[(2S)-1-(3-oxo-2-propyldodecanoyl)pyrrolidine-2-carbonyl]pyrrolidine-2-carbonyl]amino]acetyl]amino]propanoic acid.
| Compound Name | (2S)-3-(4-hydroxyphenyl)-2-[[2-[[(2S)-1-[(2S)-1-(3-oxo-2-propyldodecanoyl)pyrrolidine-2-carbonyl]pyrrolidine-2-carbonyl]amino]acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 135239463 |
| Molecular Formula | C36H54N4O8 |
| Molecular Weight | 670.85 g/mol |
| Exact Mass | 670.39 |
| IUPAC Name | (2S)-3-(4-hydroxyphenyl)-2-[[2-[[(2S)-1-[(2S)-1-(3-oxo-2-propyldodecanoyl)pyrrolidine-2-carbonyl]pyrrolidine-2-carbonyl]amino]acetyl]amino]propanoic acid |
| SMILES | CCCCCCCCCC(=O)C(CCC)C(=O)N1CCC[C@H]1C(=O)N1CCC[C@H]1C(=O)NCC(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C36H54N4O8/c1-3-5-6-7-8-9-10-16-31(42)27(13-4-2)34(45)40-22-12-15-30(40)35(46)39-21-11-14-29(39)33(44)37-24-32(43)38-28(36(47)48)23-25-17-19-26(41)20-18-25/h17-20,27-30,41H,3-16,21-24H2,1-2H3,(H,37,44)(H,38,43)(H,47,48)/t27?,28-,29-,30-/m0/s1 |
| InChIKey | LUSUHQSNIDCSQC-UOOFWSDHSA-N |
| XLogP | 3.73 |
| TPSA | 173.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.85 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|