About (2,7-dimethyl-10-propan-2-yloxycarbonyloxyanthracen-9-yl) propan-2-yl carbonate
(2,7-dimethyl-10-propan-2-yloxycarbonyloxyanthracen-9-yl) propan-2-yl carbonate (PubChem CID 135239669) has the molecular formula C24H26O6
and a molecular weight of 410.47 g/mol. Its IUPAC name is (2,7-dimethyl-10-propan-2-yloxycarbonyloxyanthracen-9-yl) propan-2-yl carbonate.
Molecular Properties
| Compound Name | (2,7-dimethyl-10-propan-2-yloxycarbonyloxyanthracen-9-yl) propan-2-yl carbonate |
| PubChem CID | 135239669 |
| Molecular Formula | C24H26O6 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | (2,7-dimethyl-10-propan-2-yloxycarbonyloxyanthracen-9-yl) propan-2-yl carbonate |
| SMILES | Cc1ccc2c(OC(=O)OC(C)C)c3ccc(C)cc3c(OC(=O)OC(C)C)c2c1 |
| InChI | InChI=1S/C24H26O6/c1-13(2)27-23(25)29-21-17-9-7-15(5)11-19(17)22(30-24(26)28-14(3)4)20-12-16(6)8-10-18(20)21/h7-14H,1-6H3 |
| InChIKey | DGHMCWKJNFYIDQ-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze (2,7-dimethyl-10-propan-2-yloxycarbonyloxyanthracen-9-yl) propan-2-yl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,7-dimethyl-10-propan-2-yloxycarbonyloxyanthracen-9-yl) propan-2-yl carbonate?
The IUPAC name of (2,7-dimethyl-10-propan-2-yloxycarbonyloxyanthracen-9-yl) propan-2-yl carbonate (CID 135239669) is (2,7-dimethyl-10-propan-2-yloxycarbonyloxyanthracen-9-yl) propan-2-yl carbonate.
What is the SMILES notation for (2,7-dimethyl-10-propan-2-yloxycarbonyloxyanthracen-9-yl) propan-2-yl carbonate?
The canonical SMILES for (2,7-dimethyl-10-propan-2-yloxycarbonyloxyanthracen-9-yl) propan-2-yl carbonate is Cc1ccc2c(OC(=O)OC(C)C)c3ccc(C)cc3c(OC(=O)OC(C)C)c2c1.
What is the InChIKey of (2,7-dimethyl-10-propan-2-yloxycarbonyloxyanthracen-9-yl) propan-2-yl carbonate?
The InChIKey is DGHMCWKJNFYIDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H26O6/c1-13(2)27-23(25)29-21-17-9-7-15(5)11-19(17)22(30-24(26)28-14(3)4)20-12-16(6)8-10-18(20)21/h7-14H,1-6H3.
What are the key properties of (2,7-dimethyl-10-propan-2-yloxycarbonyloxyanthracen-9-yl) propan-2-yl carbonate?
(2,7-dimethyl-10-propan-2-yloxycarbonyloxyanthracen-9-yl) propan-2-yl carbonate has a molecular weight of 410.47 g/mol, XLogP of 6.46, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2,7-dimethyl-10-propan-2-yloxycarbonyloxyanthracen-9-yl) propan-2-yl carbonate is sourced from PubChem (CID 135239669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).