(2R)-4,4-difluoro-2-(hydroxymethyl)piperidine-1-carboxylic acid

C7H11F2NO3 — CID 135240435

IUPAC(2R)-4,4-difluoro-2-(hydroxymethyl)piperidine-1-carboxylic acid
SMILESO=C(O)N1CCC(F)(F)C[C@@H]1CO
InChIInChI=1S/C7H11F2NO3/c8-7(9)1-2-10(6(12)13)5(3-7)4-11/h5,11H,1-4H2,(H,12,13)/t5-/m1/s1
InChIKeyNUPBPJAQDMXHEZ-RXMQYKEDSA-N
MW195.16 g/mol
LogP0.76
Rot. Bonds1

About (2R)-4,4-difluoro-2-(hydroxymethyl)piperidine-1-carboxylic acid

(2R)-4,4-difluoro-2-(hydroxymethyl)piperidine-1-carboxylic acid (PubChem CID 135240435) has the molecular formula C7H11F2NO3 and a molecular weight of 195.16 g/mol. Its IUPAC name is (2R)-4,4-difluoro-2-(hydroxymethyl)piperidine-1-carboxylic acid.

Molecular Properties

Compound Name(2R)-4,4-difluoro-2-(hydroxymethyl)piperidine-1-carboxylic acid
PubChem CID135240435
Molecular FormulaC7H11F2NO3
Molecular Weight195.16 g/mol
Exact Mass195.07
IUPAC Name(2R)-4,4-difluoro-2-(hydroxymethyl)piperidine-1-carboxylic acid
SMILESO=C(O)N1CCC(F)(F)C[C@@H]1CO
InChIInChI=1S/C7H11F2NO3/c8-7(9)1-2-10(6(12)13)5(3-7)4-11/h5,11H,1-4H2,(H,12,13)/t5-/m1/s1
InChIKeyNUPBPJAQDMXHEZ-RXMQYKEDSA-N
XLogP0.76
TPSA60.77 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500195.16
LogP ≤ 50.76
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze (2R)-4,4-difluoro-2-(hydroxymethyl)piperidine-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2R)-4,4-difluoro-2-(hydroxymethyl)piperidine-1-carboxylic acid?
The IUPAC name of (2R)-4,4-difluoro-2-(hydroxymethyl)piperidine-1-carboxylic acid (CID 135240435) is (2R)-4,4-difluoro-2-(hydroxymethyl)piperidine-1-carboxylic acid.
What is the SMILES notation for (2R)-4,4-difluoro-2-(hydroxymethyl)piperidine-1-carboxylic acid?
The canonical SMILES for (2R)-4,4-difluoro-2-(hydroxymethyl)piperidine-1-carboxylic acid is O=C(O)N1CCC(F)(F)C[C@@H]1CO.
What is the InChIKey of (2R)-4,4-difluoro-2-(hydroxymethyl)piperidine-1-carboxylic acid?
The InChIKey is NUPBPJAQDMXHEZ-RXMQYKEDSA-N. The full InChI is InChI=1S/C7H11F2NO3/c8-7(9)1-2-10(6(12)13)5(3-7)4-11/h5,11H,1-4H2,(H,12,13)/t5-/m1/s1.
What are the key properties of (2R)-4,4-difluoro-2-(hydroxymethyl)piperidine-1-carboxylic acid?
(2R)-4,4-difluoro-2-(hydroxymethyl)piperidine-1-carboxylic acid has a molecular weight of 195.16 g/mol, XLogP of 0.76, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-4,4-difluoro-2-(hydroxymethyl)piperidine-1-carboxylic acid is sourced from PubChem (CID 135240435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).