C16H18F2N4OS — CID 135240511
2-[6-[(4,4-difluorocyclohexyl)amino]-2-(4-methyl-1,3-thiazol-2-yl)pyrimidin-4-yl]acetaldehyde (PubChem CID 135240511) has the molecular formula C16H18F2N4OS and a molecular weight of 352.41 g/mol. Its IUPAC name is 2-[6-[(4,4-difluorocyclohexyl)amino]-2-(4-methyl-1,3-thiazol-2-yl)pyrimidin-4-yl]acetaldehyde.
| Compound Name | 2-[6-[(4,4-difluorocyclohexyl)amino]-2-(4-methyl-1,3-thiazol-2-yl)pyrimidin-4-yl]acetaldehyde |
|---|---|
| PubChem CID | 135240511 |
| Molecular Formula | C16H18F2N4OS |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | 2-[6-[(4,4-difluorocyclohexyl)amino]-2-(4-methyl-1,3-thiazol-2-yl)pyrimidin-4-yl]acetaldehyde |
| SMILES | Cc1csc(-c2nc(CC=O)cc(NC3CCC(F)(F)CC3)n2)n1 |
| InChI | InChI=1S/C16H18F2N4OS/c1-10-9-24-15(19-10)14-21-12(4-7-23)8-13(22-14)20-11-2-5-16(17,18)6-3-11/h7-9,11H,2-6H2,1H3,(H,20,21,22) |
| InChIKey | DTARNIWDMSEUMG-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|