About 4-oxo-6,7-dihydro-5H-pyrazolo[1,5-a]pyrazine-3-sulfonamide
4-oxo-6,7-dihydro-5H-pyrazolo[1,5-a]pyrazine-3-sulfonamide (PubChem CID 135240872) has the molecular formula C6H8N4O3S
and a molecular weight of 216.22 g/mol. Its IUPAC name is 4-oxo-6,7-dihydro-5H-pyrazolo[1,5-a]pyrazine-3-sulfonamide.
Molecular Properties
| Compound Name | 4-oxo-6,7-dihydro-5H-pyrazolo[1,5-a]pyrazine-3-sulfonamide |
| PubChem CID | 135240872 |
| Molecular Formula | C6H8N4O3S |
| Molecular Weight | 216.22 g/mol |
| Exact Mass | 216.03 |
| IUPAC Name | 4-oxo-6,7-dihydro-5H-pyrazolo[1,5-a]pyrazine-3-sulfonamide |
| SMILES | NS(=O)(=O)c1cnn2c1C(=O)NCC2 |
| InChI | InChI=1S/C6H8N4O3S/c7-14(12,13)4-3-9-10-2-1-8-6(11)5(4)10/h3H,1-2H2,(H,8,11)(H2,7,12,13) |
| InChIKey | RNMXYISRXAJOIH-UHFFFAOYSA-N |
| XLogP | -1.73 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.22 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-oxo-6,7-dihydro-5H-pyrazolo[1,5-a]pyrazine-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxo-6,7-dihydro-5H-pyrazolo[1,5-a]pyrazine-3-sulfonamide?
The IUPAC name of 4-oxo-6,7-dihydro-5H-pyrazolo[1,5-a]pyrazine-3-sulfonamide (CID 135240872) is 4-oxo-6,7-dihydro-5H-pyrazolo[1,5-a]pyrazine-3-sulfonamide.
What is the SMILES notation for 4-oxo-6,7-dihydro-5H-pyrazolo[1,5-a]pyrazine-3-sulfonamide?
The canonical SMILES for 4-oxo-6,7-dihydro-5H-pyrazolo[1,5-a]pyrazine-3-sulfonamide is NS(=O)(=O)c1cnn2c1C(=O)NCC2.
What is the InChIKey of 4-oxo-6,7-dihydro-5H-pyrazolo[1,5-a]pyrazine-3-sulfonamide?
The InChIKey is RNMXYISRXAJOIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N4O3S/c7-14(12,13)4-3-9-10-2-1-8-6(11)5(4)10/h3H,1-2H2,(H,8,11)(H2,7,12,13).
What are the key properties of 4-oxo-6,7-dihydro-5H-pyrazolo[1,5-a]pyrazine-3-sulfonamide?
4-oxo-6,7-dihydro-5H-pyrazolo[1,5-a]pyrazine-3-sulfonamide has a molecular weight of 216.22 g/mol, XLogP of -1.73, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxo-6,7-dihydro-5H-pyrazolo[1,5-a]pyrazine-3-sulfonamide is sourced from PubChem (CID 135240872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).