About 5-methyl-4-oxo-6,7-dihydropyrazolo[1,5-a]pyrazine-2-sulfonamide
5-methyl-4-oxo-6,7-dihydropyrazolo[1,5-a]pyrazine-2-sulfonamide (PubChem CID 135241021) has the molecular formula C7H10N4O3S
and a molecular weight of 230.25 g/mol. Its IUPAC name is 5-methyl-4-oxo-6,7-dihydropyrazolo[1,5-a]pyrazine-2-sulfonamide.
Molecular Properties
| Compound Name | 5-methyl-4-oxo-6,7-dihydropyrazolo[1,5-a]pyrazine-2-sulfonamide |
| PubChem CID | 135241021 |
| Molecular Formula | C7H10N4O3S |
| Molecular Weight | 230.25 g/mol |
| Exact Mass | 230.05 |
| IUPAC Name | 5-methyl-4-oxo-6,7-dihydropyrazolo[1,5-a]pyrazine-2-sulfonamide |
| SMILES | CN1CCn2nc(S(N)(=O)=O)cc2C1=O |
| InChI | InChI=1S/C7H10N4O3S/c1-10-2-3-11-5(7(10)12)4-6(9-11)15(8,13)14/h4H,2-3H2,1H3,(H2,8,13,14) |
| InChIKey | WQHVSFOKYOKLES-UHFFFAOYSA-N |
| XLogP | -1.38 |
| TPSA | 98.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.25 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-methyl-4-oxo-6,7-dihydropyrazolo[1,5-a]pyrazine-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-4-oxo-6,7-dihydropyrazolo[1,5-a]pyrazine-2-sulfonamide?
The IUPAC name of 5-methyl-4-oxo-6,7-dihydropyrazolo[1,5-a]pyrazine-2-sulfonamide (CID 135241021) is 5-methyl-4-oxo-6,7-dihydropyrazolo[1,5-a]pyrazine-2-sulfonamide.
What is the SMILES notation for 5-methyl-4-oxo-6,7-dihydropyrazolo[1,5-a]pyrazine-2-sulfonamide?
The canonical SMILES for 5-methyl-4-oxo-6,7-dihydropyrazolo[1,5-a]pyrazine-2-sulfonamide is CN1CCn2nc(S(N)(=O)=O)cc2C1=O.
What is the InChIKey of 5-methyl-4-oxo-6,7-dihydropyrazolo[1,5-a]pyrazine-2-sulfonamide?
The InChIKey is WQHVSFOKYOKLES-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N4O3S/c1-10-2-3-11-5(7(10)12)4-6(9-11)15(8,13)14/h4H,2-3H2,1H3,(H2,8,13,14).
What are the key properties of 5-methyl-4-oxo-6,7-dihydropyrazolo[1,5-a]pyrazine-2-sulfonamide?
5-methyl-4-oxo-6,7-dihydropyrazolo[1,5-a]pyrazine-2-sulfonamide has a molecular weight of 230.25 g/mol, XLogP of -1.38, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-4-oxo-6,7-dihydropyrazolo[1,5-a]pyrazine-2-sulfonamide is sourced from PubChem (CID 135241021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).