C25H29N3O2 — CID 135241050
2-methyl-4-[3-[4-(2-piperidin-1-ylethoxy)phenyl]pyrazolo[1,5-a]pyridin-4-yl]but-3-yn-2-ol (PubChem CID 135241050) has the molecular formula C25H29N3O2 and a molecular weight of 403.53 g/mol. Its IUPAC name is 2-methyl-4-[3-[4-(2-piperidin-1-ylethoxy)phenyl]pyrazolo[1,5-a]pyridin-4-yl]but-3-yn-2-ol.
| Compound Name | 2-methyl-4-[3-[4-(2-piperidin-1-ylethoxy)phenyl]pyrazolo[1,5-a]pyridin-4-yl]but-3-yn-2-ol |
|---|---|
| PubChem CID | 135241050 |
| Molecular Formula | C25H29N3O2 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | 2-methyl-4-[3-[4-(2-piperidin-1-ylethoxy)phenyl]pyrazolo[1,5-a]pyridin-4-yl]but-3-yn-2-ol |
| SMILES | CC(C)(O)C#Cc1cccn2ncc(-c3ccc(OCCN4CCCCC4)cc3)c12 |
| InChI | InChI=1S/C25H29N3O2/c1-25(2,29)13-12-21-7-6-16-28-24(21)23(19-26-28)20-8-10-22(11-9-20)30-18-17-27-14-4-3-5-15-27/h6-11,16,19,29H,3-5,14-15,17-18H2,1-2H3 |
| InChIKey | VUDFWBIGGCCOMF-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 50.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|