C8H10F3N3O2 — CID 135241091
6-(trifluoromethyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 135241091) has the molecular formula C8H10F3N3O2 and a molecular weight of 237.18 g/mol. Its IUPAC name is 6-(trifluoromethyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 6-(trifluoromethyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 135241091 |
| Molecular Formula | C8H10F3N3O2 |
| Molecular Weight | 237.18 g/mol |
| Exact Mass | 237.07 |
| IUPAC Name | 6-(trifluoromethyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | O=C1NC(=O)C2(CCNCC2C(F)(F)F)N1 |
| InChI | InChI=1S/C8H10F3N3O2/c9-8(10,11)4-3-12-2-1-7(4)5(15)13-6(16)14-7/h4,12H,1-3H2,(H2,13,14,15,16) |
| InChIKey | IXNIHJUMDNAHHX-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.18 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|