C18H21N3O2 — CID 135241712
5-[(5-cyclohexyl-2-pyridinyl)methylamino]pyridine-2-carboxylic acid (PubChem CID 135241712) has the molecular formula C18H21N3O2 and a molecular weight of 311.38 g/mol. Its IUPAC name is 5-[(5-cyclohexyl-2-pyridinyl)methylamino]pyridine-2-carboxylic acid.
| Compound Name | 5-[(5-cyclohexyl-2-pyridinyl)methylamino]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 135241712 |
| Molecular Formula | C18H21N3O2 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | 5-[(5-cyclohexyl-2-pyridinyl)methylamino]pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(NCc2ccc(C3CCCCC3)cn2)cn1 |
| InChI | InChI=1S/C18H21N3O2/c22-18(23)17-9-8-16(12-21-17)20-11-15-7-6-14(10-19-15)13-4-2-1-3-5-13/h6-10,12-13,20H,1-5,11H2,(H,22,23) |
| InChIKey | XNVXMTHSTKKRJL-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |