C29H27F5N4O6S — CID 135241818
(2R)-N-[(5-cyclohexyl-2-pyridinyl)methyl]-N-[3-hydroxy-4-(hydroxycarbamoyl)phenyl]-1-(2,3,4,5,6-pentafluorophenyl)sulfonylazetidine-2-carboxamide (PubChem CID 135241818) has the molecular formula C29H27F5N4O6S and a molecular weight of 654.61 g/mol. Its IUPAC name is (2R)-N-[(5-cyclohexyl-2-pyridinyl)methyl]-N-[3-hydroxy-4-(hydroxycarbamoyl)phenyl]-1-(2,3,4,5,6-pentafluorophenyl)sulfonylazetidine-2-carboxamide.
| Compound Name | (2R)-N-[(5-cyclohexyl-2-pyridinyl)methyl]-N-[3-hydroxy-4-(hydroxycarbamoyl)phenyl]-1-(2,3,4,5,6-pentafluorophenyl)sulfonylazetidine-2-carboxamide |
|---|---|
| PubChem CID | 135241818 |
| Molecular Formula | C29H27F5N4O6S |
| Molecular Weight | 654.61 g/mol |
| Exact Mass | 654.16 |
| IUPAC Name | (2R)-N-[(5-cyclohexyl-2-pyridinyl)methyl]-N-[3-hydroxy-4-(hydroxycarbamoyl)phenyl]-1-(2,3,4,5,6-pentafluorophenyl)sulfonylazetidine-2-carboxamide |
| SMILES | O=C(NO)c1ccc(N(Cc2ccc(C3CCCCC3)cn2)C(=O)[C@H]2CCN2S(=O)(=O)c2c(F)c(F)c(F)c(F)c2F)cc1O |
| InChI | InChI=1S/C29H27F5N4O6S/c30-22-23(31)25(33)27(26(34)24(22)32)45(43,44)38-11-10-20(38)29(41)37(18-8-9-19(21(39)12-18)28(40)36-42)14-17-7-6-16(13-35-17)15-4-2-1-3-5-15/h6-9,12-13,15,20,39,42H,1-5,10-11,14H2,(H,36,40)/t20-/m1/s1 |
| InChIKey | LLPGZWIIGINNHR-HXUWFJFHSA-N |
| XLogP | 4.65 |
| TPSA | 140.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.61 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|