C29H27F5N4O5S — CID 135241906
(2R)-N-(4-carbamoyl-3-hydroxyphenyl)-N-[(5-cyclohexyl-2-pyridinyl)methyl]-1-(2,3,4,5,6-pentafluorophenyl)sulfonylazetidine-2-carboxamide (PubChem CID 135241906) has the molecular formula C29H27F5N4O5S and a molecular weight of 638.62 g/mol. Its IUPAC name is (2R)-N-(4-carbamoyl-3-hydroxyphenyl)-N-[(5-cyclohexyl-2-pyridinyl)methyl]-1-(2,3,4,5,6-pentafluorophenyl)sulfonylazetidine-2-carboxamide.
| Compound Name | (2R)-N-(4-carbamoyl-3-hydroxyphenyl)-N-[(5-cyclohexyl-2-pyridinyl)methyl]-1-(2,3,4,5,6-pentafluorophenyl)sulfonylazetidine-2-carboxamide |
|---|---|
| PubChem CID | 135241906 |
| Molecular Formula | C29H27F5N4O5S |
| Molecular Weight | 638.62 g/mol |
| Exact Mass | 638.16 |
| IUPAC Name | (2R)-N-(4-carbamoyl-3-hydroxyphenyl)-N-[(5-cyclohexyl-2-pyridinyl)methyl]-1-(2,3,4,5,6-pentafluorophenyl)sulfonylazetidine-2-carboxamide |
| SMILES | NC(=O)c1ccc(N(Cc2ccc(C3CCCCC3)cn2)C(=O)[C@H]2CCN2S(=O)(=O)c2c(F)c(F)c(F)c(F)c2F)cc1O |
| InChI | InChI=1S/C29H27F5N4O5S/c30-22-23(31)25(33)27(26(34)24(22)32)44(42,43)38-11-10-20(38)29(41)37(18-8-9-19(28(35)40)21(39)12-18)14-17-7-6-16(13-36-17)15-4-2-1-3-5-15/h6-9,12-13,15,20,39H,1-5,10-11,14H2,(H2,35,40)/t20-/m1/s1 |
| InChIKey | PXNSBTUJZQMIBW-HXUWFJFHSA-N |
| XLogP | 4.63 |
| TPSA | 133.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.62 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|