C8H10ClF4N3O2 — CID 135241984
6-fluoro-6-(trifluoromethyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione;hydrochloride (PubChem CID 135241984) has the molecular formula C8H10ClF4N3O2 and a molecular weight of 291.63 g/mol. Its IUPAC name is 6-fluoro-6-(trifluoromethyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione;hydrochloride.
| Compound Name | 6-fluoro-6-(trifluoromethyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione;hydrochloride |
|---|---|
| PubChem CID | 135241984 |
| Molecular Formula | C8H10ClF4N3O2 |
| Molecular Weight | 291.63 g/mol |
| Exact Mass | 291.04 |
| IUPAC Name | 6-fluoro-6-(trifluoromethyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione;hydrochloride |
| SMILES | Cl.O=C1NC(=O)C2(CCNCC2(F)C(F)(F)F)N1 |
| InChI | InChI=1S/C8H9F4N3O2.ClH/c9-7(8(10,11)12)3-13-2-1-6(7)4(16)14-5(17)15-6;/h13H,1-3H2,(H2,14,15,16,17);1H |
| InChIKey | WURZQJXBYBMSAB-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.63 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|