C30H29F5N4O6S — CID 135242115
(2R)-N-[(5-cyclohexyl-2-pyridinyl)methyl]-N-[3-hydroxy-4-(methoxycarbamoyl)phenyl]-1-(2,3,4,5,6-pentafluorophenyl)sulfonylazetidine-2-carboxamide (PubChem CID 135242115) has the molecular formula C30H29F5N4O6S and a molecular weight of 668.64 g/mol. Its IUPAC name is (2R)-N-[(5-cyclohexyl-2-pyridinyl)methyl]-N-[3-hydroxy-4-(methoxycarbamoyl)phenyl]-1-(2,3,4,5,6-pentafluorophenyl)sulfonylazetidine-2-carboxamide.
| Compound Name | (2R)-N-[(5-cyclohexyl-2-pyridinyl)methyl]-N-[3-hydroxy-4-(methoxycarbamoyl)phenyl]-1-(2,3,4,5,6-pentafluorophenyl)sulfonylazetidine-2-carboxamide |
|---|---|
| PubChem CID | 135242115 |
| Molecular Formula | C30H29F5N4O6S |
| Molecular Weight | 668.64 g/mol |
| Exact Mass | 668.17 |
| IUPAC Name | (2R)-N-[(5-cyclohexyl-2-pyridinyl)methyl]-N-[3-hydroxy-4-(methoxycarbamoyl)phenyl]-1-(2,3,4,5,6-pentafluorophenyl)sulfonylazetidine-2-carboxamide |
| SMILES | CONC(=O)c1ccc(N(Cc2ccc(C3CCCCC3)cn2)C(=O)[C@H]2CCN2S(=O)(=O)c2c(F)c(F)c(F)c(F)c2F)cc1O |
| InChI | InChI=1S/C30H29F5N4O6S/c1-45-37-29(41)20-10-9-19(13-22(20)40)38(15-18-8-7-17(14-36-18)16-5-3-2-4-6-16)30(42)21-11-12-39(21)46(43,44)28-26(34)24(32)23(31)25(33)27(28)35/h7-10,13-14,16,21,40H,2-6,11-12,15H2,1H3,(H,37,41)/t21-/m1/s1 |
| InChIKey | XAEGGAXKSSKHBI-OAQYLSRUSA-N |
| XLogP | 4.82 |
| TPSA | 129.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.64 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|