C44H38N4O — CID 135242495
4-amino-10-[1-(4-amino-10-propan-2-ylspiro[acridine-9,9'-fluorene]-3'-yl)propan-2-yl]acridin-9-one (PubChem CID 135242495) has the molecular formula C44H38N4O and a molecular weight of 638.82 g/mol. Its IUPAC name is 4-amino-10-[1-(4-amino-10-propan-2-ylspiro[acridine-9,9'-fluorene]-3'-yl)propan-2-yl]acridin-9-one.
| Compound Name | 4-amino-10-[1-(4-amino-10-propan-2-ylspiro[acridine-9,9'-fluorene]-3'-yl)propan-2-yl]acridin-9-one |
|---|---|
| PubChem CID | 135242495 |
| Molecular Formula | C44H38N4O |
| Molecular Weight | 638.82 g/mol |
| Exact Mass | 638.30 |
| IUPAC Name | 4-amino-10-[1-(4-amino-10-propan-2-ylspiro[acridine-9,9'-fluorene]-3'-yl)propan-2-yl]acridin-9-one |
| SMILES | CC(C)N1c2ccccc2C2(c3ccccc3-c3cc(CC(C)n4c5ccccc5c(=O)c5cccc(N)c54)ccc32)c2cccc(N)c21 |
| InChI | InChI=1S/C44H38N4O/c1-26(2)47-40-21-9-7-16-35(40)44(36-17-11-19-38(46)42(36)47)33-15-6-4-12-29(33)32-25-28(22-23-34(32)44)24-27(3)48-39-20-8-5-13-30(39)43(49)31-14-10-18-37(45)41(31)48/h4-23,25-27H,24,45-46H2,1-3H3 |
| InChIKey | AZTVAGUOZCBUBO-UHFFFAOYSA-N |
| XLogP | 9.35 |
| TPSA | 77.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.82 |
| LogP ≤ 5 | 9.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|