C14H20O4 — CID 135242532
methyl 2-[(1S,3R,6S,8R,9R,11R)-2,7-dioxatetracyclo[6.4.1.01,6.09,11]tridecan-3-yl]acetate (PubChem CID 135242532) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is methyl 2-[(1S,3R,6S,8R,9R,11R)-2,7-dioxatetracyclo[6.4.1.01,6.09,11]tridecan-3-yl]acetate.
| Compound Name | methyl 2-[(1S,3R,6S,8R,9R,11R)-2,7-dioxatetracyclo[6.4.1.01,6.09,11]tridecan-3-yl]acetate |
|---|---|
| PubChem CID | 135242532 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | methyl 2-[(1S,3R,6S,8R,9R,11R)-2,7-dioxatetracyclo[6.4.1.01,6.09,11]tridecan-3-yl]acetate |
| SMILES | COC(=O)C[C@H]1CC[C@@H]2O[C@@H]3C[C@]2(C[C@H]2C[C@H]23)O1 |
| InChI | InChI=1S/C14H20O4/c1-16-13(15)5-9-2-3-12-14(18-9)6-8-4-10(8)11(7-14)17-12/h8-12H,2-7H2,1H3/t8-,9-,10-,11-,12+,14+/m1/s1 |
| InChIKey | UEDTYAXAKPDXBB-QOXTVGHNSA-N |
| XLogP | 1.66 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |