C13H18O5 — CID 135242593
2-[(1R,4S,11R)-3,8,12-trioxatetracyclo[7.3.2.01,11.04,9]tetradecan-7-yl]acetic acid (PubChem CID 135242593) has the molecular formula C13H18O5 and a molecular weight of 254.28 g/mol. Its IUPAC name is 2-[(1R,4S,11R)-3,8,12-trioxatetracyclo[7.3.2.01,11.04,9]tetradecan-7-yl]acetic acid.
| Compound Name | 2-[(1R,4S,11R)-3,8,12-trioxatetracyclo[7.3.2.01,11.04,9]tetradecan-7-yl]acetic acid |
|---|---|
| PubChem CID | 135242593 |
| Molecular Formula | C13H18O5 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 2-[(1R,4S,11R)-3,8,12-trioxatetracyclo[7.3.2.01,11.04,9]tetradecan-7-yl]acetic acid |
| SMILES | O=C(O)CC1CC[C@@H]2OC[C@]34CCC2(C[C@H]3O4)O1 |
| InChI | InChI=1S/C13H18O5/c14-11(15)5-8-1-2-9-12(17-8)3-4-13(7-16-9)10(6-12)18-13/h8-10H,1-7H2,(H,14,15)/t8?,9-,10+,12?,13+/m0/s1 |
| InChIKey | IYRBEVHDFADGMT-NJVCWHAMSA-N |
| XLogP | 1.10 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|