C45H56NO3P — CID 135242638
(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) (E)-10-(4-diphenylphosphanylphenyl)-8-phenyldodec-5-enoate (PubChem CID 135242638) has the molecular formula C45H56NO3P and a molecular weight of 689.92 g/mol. Its IUPAC name is (1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) (E)-10-(4-diphenylphosphanylphenyl)-8-phenyldodec-5-enoate.
| Compound Name | (1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) (E)-10-(4-diphenylphosphanylphenyl)-8-phenyldodec-5-enoate |
|---|---|
| PubChem CID | 135242638 |
| Molecular Formula | C45H56NO3P |
| Molecular Weight | 689.92 g/mol |
| Exact Mass | 689.40 |
| IUPAC Name | (1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) (E)-10-(4-diphenylphosphanylphenyl)-8-phenyldodec-5-enoate |
| SMILES | CCC(CC(C/C=C/CCCC(=O)OC1CC(C)(C)N(O)C(C)(C)C1)c1ccccc1)c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C45H56NO3P/c1-6-35(37-28-30-42(31-29-37)50(40-23-15-10-16-24-40)41-25-17-11-18-26-41)32-38(36-20-13-9-14-21-36)22-12-7-8-19-27-43(47)49-39-33-44(2,3)46(48)45(4,5)34-39/h7,9-18,20-21,23-26,28-31,35,38-39,48H,6,8,19,22,27,32-34H2,1-5H3/b12-7+ |
| InChIKey | NAQZJPVDMAMQAR-KPKJPENVSA-N |
| XLogP | 10.18 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.92 |
| LogP ≤ 5 | 10.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|