About N-[(3Z)-hexa-1,3-dien-2-yl]-N'-methylmethanimidamide
N-[(3Z)-hexa-1,3-dien-2-yl]-N'-methylmethanimidamide (PubChem CID 135243160) has the molecular formula C8H14N2
and a molecular weight of 138.21 g/mol. Its IUPAC name is N-[(3Z)-hexa-1,3-dien-2-yl]-N'-methylmethanimidamide.
Molecular Properties
| Compound Name | N-[(3Z)-hexa-1,3-dien-2-yl]-N'-methylmethanimidamide |
| PubChem CID | 135243160 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | N-[(3Z)-hexa-1,3-dien-2-yl]-N'-methylmethanimidamide |
| SMILES | C=C(/C=C\CC)N/C=N/C |
| InChI | InChI=1S/C8H14N2/c1-4-5-6-8(2)10-7-9-3/h5-7H,2,4H2,1,3H3,(H,9,10)/b6-5- |
| InChIKey | DGBFZRRMCLLNBW-WAYWQWQTSA-N |
| XLogP | 1.71 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(3Z)-hexa-1,3-dien-2-yl]-N'-methylmethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3Z)-hexa-1,3-dien-2-yl]-N'-methylmethanimidamide?
The IUPAC name of N-[(3Z)-hexa-1,3-dien-2-yl]-N'-methylmethanimidamide (CID 135243160) is N-[(3Z)-hexa-1,3-dien-2-yl]-N'-methylmethanimidamide.
What is the SMILES notation for N-[(3Z)-hexa-1,3-dien-2-yl]-N'-methylmethanimidamide?
The canonical SMILES for N-[(3Z)-hexa-1,3-dien-2-yl]-N'-methylmethanimidamide is C=C(/C=C\CC)N/C=N/C.
What is the InChIKey of N-[(3Z)-hexa-1,3-dien-2-yl]-N'-methylmethanimidamide?
The InChIKey is DGBFZRRMCLLNBW-WAYWQWQTSA-N. The full InChI is InChI=1S/C8H14N2/c1-4-5-6-8(2)10-7-9-3/h5-7H,2,4H2,1,3H3,(H,9,10)/b6-5-.
What are the key properties of N-[(3Z)-hexa-1,3-dien-2-yl]-N'-methylmethanimidamide?
N-[(3Z)-hexa-1,3-dien-2-yl]-N'-methylmethanimidamide has a molecular weight of 138.21 g/mol, XLogP of 1.71, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3Z)-hexa-1,3-dien-2-yl]-N'-methylmethanimidamide is sourced from PubChem (CID 135243160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).