About N'-methyl-N-[(2E)-penta-2,4-dien-2-yl]methanimidamide
N'-methyl-N-[(2E)-penta-2,4-dien-2-yl]methanimidamide (PubChem CID 135243191) has the molecular formula C7H12N2
and a molecular weight of 124.19 g/mol. Its IUPAC name is N'-methyl-N-[(2E)-penta-2,4-dien-2-yl]methanimidamide.
Molecular Properties
| Compound Name | N'-methyl-N-[(2E)-penta-2,4-dien-2-yl]methanimidamide |
| PubChem CID | 135243191 |
| Molecular Formula | C7H12N2 |
| Molecular Weight | 124.19 g/mol |
| Exact Mass | 124.10 |
| IUPAC Name | N'-methyl-N-[(2E)-penta-2,4-dien-2-yl]methanimidamide |
| SMILES | C=C/C=C(\C)N/C=N/C |
| InChI | InChI=1S/C7H12N2/c1-4-5-7(2)9-6-8-3/h4-6H,1H2,2-3H3,(H,8,9)/b7-5+ |
| InChIKey | BIPNBGRRNCRMFI-FNORWQNLSA-N |
| XLogP | 1.32 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.19 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N'-methyl-N-[(2E)-penta-2,4-dien-2-yl]methanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-methyl-N-[(2E)-penta-2,4-dien-2-yl]methanimidamide?
The IUPAC name of N'-methyl-N-[(2E)-penta-2,4-dien-2-yl]methanimidamide (CID 135243191) is N'-methyl-N-[(2E)-penta-2,4-dien-2-yl]methanimidamide.
What is the SMILES notation for N'-methyl-N-[(2E)-penta-2,4-dien-2-yl]methanimidamide?
The canonical SMILES for N'-methyl-N-[(2E)-penta-2,4-dien-2-yl]methanimidamide is C=C/C=C(\C)N/C=N/C.
What is the InChIKey of N'-methyl-N-[(2E)-penta-2,4-dien-2-yl]methanimidamide?
The InChIKey is BIPNBGRRNCRMFI-FNORWQNLSA-N. The full InChI is InChI=1S/C7H12N2/c1-4-5-7(2)9-6-8-3/h4-6H,1H2,2-3H3,(H,8,9)/b7-5+.
What are the key properties of N'-methyl-N-[(2E)-penta-2,4-dien-2-yl]methanimidamide?
N'-methyl-N-[(2E)-penta-2,4-dien-2-yl]methanimidamide has a molecular weight of 124.19 g/mol, XLogP of 1.32, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N'-methyl-N-[(2E)-penta-2,4-dien-2-yl]methanimidamide is sourced from PubChem (CID 135243191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).