About N'-buta-1,3-dien-2-yl-N-methyl-N-propan-2-ylmethanimidamide
N'-buta-1,3-dien-2-yl-N-methyl-N-propan-2-ylmethanimidamide (PubChem CID 135243192) has the molecular formula C9H16N2
and a molecular weight of 152.24 g/mol. Its IUPAC name is N'-buta-1,3-dien-2-yl-N-methyl-N-propan-2-ylmethanimidamide.
Molecular Properties
| Compound Name | N'-buta-1,3-dien-2-yl-N-methyl-N-propan-2-ylmethanimidamide |
| PubChem CID | 135243192 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | N'-buta-1,3-dien-2-yl-N-methyl-N-propan-2-ylmethanimidamide |
| SMILES | C=CC(=C)/N=C/N(C)C(C)C |
| InChI | InChI=1S/C9H16N2/c1-6-9(4)10-7-11(5)8(2)3/h6-8H,1,4H2,2-3,5H3/b10-7+ |
| InChIKey | REDJHBFOOBXLQA-JXMROGBWSA-N |
| XLogP | 2.05 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N'-buta-1,3-dien-2-yl-N-methyl-N-propan-2-ylmethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-buta-1,3-dien-2-yl-N-methyl-N-propan-2-ylmethanimidamide?
The IUPAC name of N'-buta-1,3-dien-2-yl-N-methyl-N-propan-2-ylmethanimidamide (CID 135243192) is N'-buta-1,3-dien-2-yl-N-methyl-N-propan-2-ylmethanimidamide.
What is the SMILES notation for N'-buta-1,3-dien-2-yl-N-methyl-N-propan-2-ylmethanimidamide?
The canonical SMILES for N'-buta-1,3-dien-2-yl-N-methyl-N-propan-2-ylmethanimidamide is C=CC(=C)/N=C/N(C)C(C)C.
What is the InChIKey of N'-buta-1,3-dien-2-yl-N-methyl-N-propan-2-ylmethanimidamide?
The InChIKey is REDJHBFOOBXLQA-JXMROGBWSA-N. The full InChI is InChI=1S/C9H16N2/c1-6-9(4)10-7-11(5)8(2)3/h6-8H,1,4H2,2-3,5H3/b10-7+.
What are the key properties of N'-buta-1,3-dien-2-yl-N-methyl-N-propan-2-ylmethanimidamide?
N'-buta-1,3-dien-2-yl-N-methyl-N-propan-2-ylmethanimidamide has a molecular weight of 152.24 g/mol, XLogP of 2.05, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N'-buta-1,3-dien-2-yl-N-methyl-N-propan-2-ylmethanimidamide is sourced from PubChem (CID 135243192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).