C14H21F6NO5S2 — CID 135243257
3-[(3-ethyl-3-bicyclo[3.3.1]nonanyl)sulfamoyl]-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid (PubChem CID 135243257) has the molecular formula C14H21F6NO5S2 and a molecular weight of 461.45 g/mol. Its IUPAC name is 3-[(3-ethyl-3-bicyclo[3.3.1]nonanyl)sulfamoyl]-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid.
| Compound Name | 3-[(3-ethyl-3-bicyclo[3.3.1]nonanyl)sulfamoyl]-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid |
|---|---|
| PubChem CID | 135243257 |
| Molecular Formula | C14H21F6NO5S2 |
| Molecular Weight | 461.45 g/mol |
| Exact Mass | 461.08 |
| IUPAC Name | 3-[(3-ethyl-3-bicyclo[3.3.1]nonanyl)sulfamoyl]-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid |
| SMILES | CCC1(NS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)O)CC2CCCC(C2)C1 |
| InChI | InChI=1S/C14H21F6NO5S2/c1-2-11(7-9-4-3-5-10(6-9)8-11)21-27(22,23)13(17,18)12(15,16)14(19,20)28(24,25)26/h9-10,21H,2-8H2,1H3,(H,24,25,26) |
| InChIKey | XKWPNXJGQKDFDM-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.45 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|