About 4,9-dimethylidene-2-propan-2-yl-1H-1,3-diazonine
4,9-dimethylidene-2-propan-2-yl-1H-1,3-diazonine (PubChem CID 135243264) has the molecular formula C12H16N2
and a molecular weight of 188.27 g/mol. Its IUPAC name is 4,9-dimethylidene-2-propan-2-yl-1H-1,3-diazonine.
Molecular Properties
| Compound Name | 4,9-dimethylidene-2-propan-2-yl-1H-1,3-diazonine |
| PubChem CID | 135243264 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 4,9-dimethylidene-2-propan-2-yl-1H-1,3-diazonine |
| SMILES | C=c1ccccc(=C)[nH]c(C(C)C)n1 |
| InChI | InChI=1S/C12H16N2/c1-9(2)12-13-10(3)7-5-6-8-11(4)14-12/h5-9H,3-4H2,1-2H3,(H,13,14)/b7-5-,8-6- |
| InChIKey | SMBSLBLVPWTTJM-SFECMWDFSA-N |
| XLogP | 1.48 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4,9-dimethylidene-2-propan-2-yl-1H-1,3-diazonine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,9-dimethylidene-2-propan-2-yl-1H-1,3-diazonine?
The IUPAC name of 4,9-dimethylidene-2-propan-2-yl-1H-1,3-diazonine (CID 135243264) is 4,9-dimethylidene-2-propan-2-yl-1H-1,3-diazonine.
What is the SMILES notation for 4,9-dimethylidene-2-propan-2-yl-1H-1,3-diazonine?
The canonical SMILES for 4,9-dimethylidene-2-propan-2-yl-1H-1,3-diazonine is C=c1ccccc(=C)[nH]c(C(C)C)n1.
What is the InChIKey of 4,9-dimethylidene-2-propan-2-yl-1H-1,3-diazonine?
The InChIKey is SMBSLBLVPWTTJM-SFECMWDFSA-N. The full InChI is InChI=1S/C12H16N2/c1-9(2)12-13-10(3)7-5-6-8-11(4)14-12/h5-9H,3-4H2,1-2H3,(H,13,14)/b7-5-,8-6-.
What are the key properties of 4,9-dimethylidene-2-propan-2-yl-1H-1,3-diazonine?
4,9-dimethylidene-2-propan-2-yl-1H-1,3-diazonine has a molecular weight of 188.27 g/mol, XLogP of 1.48, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,9-dimethylidene-2-propan-2-yl-1H-1,3-diazonine is sourced from PubChem (CID 135243264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).