About 7-O-benzyl 2-O-methyl 6-(difluoromethyl)-7-azabicyclo[2.2.1]heptane-2,7-dicarboxylate
7-O-benzyl 2-O-methyl 6-(difluoromethyl)-7-azabicyclo[2.2.1]heptane-2,7-dicarboxylate (PubChem CID 135243797) has the molecular formula C17H19F2NO4
and a molecular weight of 339.34 g/mol. Its IUPAC name is 7-O-benzyl 2-O-methyl 6-(difluoromethyl)-7-azabicyclo[2.2.1]heptane-2,7-dicarboxylate.
Molecular Properties
| Compound Name | 7-O-benzyl 2-O-methyl 6-(difluoromethyl)-7-azabicyclo[2.2.1]heptane-2,7-dicarboxylate |
| PubChem CID | 135243797 |
| Molecular Formula | C17H19F2NO4 |
| Molecular Weight | 339.34 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 7-O-benzyl 2-O-methyl 6-(difluoromethyl)-7-azabicyclo[2.2.1]heptane-2,7-dicarboxylate |
| SMILES | COC(=O)C1CC2CC(C(F)F)C1N2C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H19F2NO4/c1-23-16(21)13-8-11-7-12(15(18)19)14(13)20(11)17(22)24-9-10-5-3-2-4-6-10/h2-6,11-15H,7-9H2,1H3 |
| InChIKey | BTYQWTSQWFARRX-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.34 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-O-benzyl 2-O-methyl 6-(difluoromethyl)-7-azabicyclo[2.2.1]heptane-2,7-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-O-benzyl 2-O-methyl 6-(difluoromethyl)-7-azabicyclo[2.2.1]heptane-2,7-dicarboxylate?
The IUPAC name of 7-O-benzyl 2-O-methyl 6-(difluoromethyl)-7-azabicyclo[2.2.1]heptane-2,7-dicarboxylate (CID 135243797) is 7-O-benzyl 2-O-methyl 6-(difluoromethyl)-7-azabicyclo[2.2.1]heptane-2,7-dicarboxylate.
What is the SMILES notation for 7-O-benzyl 2-O-methyl 6-(difluoromethyl)-7-azabicyclo[2.2.1]heptane-2,7-dicarboxylate?
The canonical SMILES for 7-O-benzyl 2-O-methyl 6-(difluoromethyl)-7-azabicyclo[2.2.1]heptane-2,7-dicarboxylate is COC(=O)C1CC2CC(C(F)F)C1N2C(=O)OCc1ccccc1.
What is the InChIKey of 7-O-benzyl 2-O-methyl 6-(difluoromethyl)-7-azabicyclo[2.2.1]heptane-2,7-dicarboxylate?
The InChIKey is BTYQWTSQWFARRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19F2NO4/c1-23-16(21)13-8-11-7-12(15(18)19)14(13)20(11)17(22)24-9-10-5-3-2-4-6-10/h2-6,11-15H,7-9H2,1H3.
What are the key properties of 7-O-benzyl 2-O-methyl 6-(difluoromethyl)-7-azabicyclo[2.2.1]heptane-2,7-dicarboxylate?
7-O-benzyl 2-O-methyl 6-(difluoromethyl)-7-azabicyclo[2.2.1]heptane-2,7-dicarboxylate has a molecular weight of 339.34 g/mol, XLogP of 2.84, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-O-benzyl 2-O-methyl 6-(difluoromethyl)-7-azabicyclo[2.2.1]heptane-2,7-dicarboxylate is sourced from PubChem (CID 135243797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).