C30H55N3 — CID 135244010
(2Z,4E,8E)-7-(1-aminoethyl)-8-ethenyl-N,N',N',6,6,10-hexamethyl-5-pentyl-4-prop-2-enylidenedodeca-2,8-diene-1,12-diamine (PubChem CID 135244010) has the molecular formula C30H55N3 and a molecular weight of 457.79 g/mol. Its IUPAC name is (2Z,4E,8E)-7-(1-aminoethyl)-8-ethenyl-N,N',N',6,6,10-hexamethyl-5-pentyl-4-prop-2-enylidenedodeca-2,8-diene-1,12-diamine.
| Compound Name | (2Z,4E,8E)-7-(1-aminoethyl)-8-ethenyl-N,N',N',6,6,10-hexamethyl-5-pentyl-4-prop-2-enylidenedodeca-2,8-diene-1,12-diamine |
|---|---|
| PubChem CID | 135244010 |
| Molecular Formula | C30H55N3 |
| Molecular Weight | 457.79 g/mol |
| Exact Mass | 457.44 |
| IUPAC Name | (2Z,4E,8E)-7-(1-aminoethyl)-8-ethenyl-N,N',N',6,6,10-hexamethyl-5-pentyl-4-prop-2-enylidenedodeca-2,8-diene-1,12-diamine |
| SMILES | C=C/C=C(\C=C/CNC)C(CCCCC)C(C)(C)C(/C(C=C)=C/C(C)CCN(C)C)C(C)N |
| InChI | InChI=1S/C30H55N3/c1-11-14-15-19-28(27(17-12-2)18-16-21-32-8)30(6,7)29(25(5)31)26(13-3)23-24(4)20-22-33(9)10/h12-13,16-18,23-25,28-29,32H,2-3,11,14-15,19-22,31H2,1,4-10H3/b18-16-,26-23+,27-17+ |
| InChIKey | LACHUPVWBRVCFE-DPCALXPBSA-N |
| XLogP | 6.76 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.79 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|