C19H29NO8 — CID 135244012
9,10-dimethoxy-3-(2-methylpropyl)-1,2,3,4-tetrahydrobenzo[a]quinolizine-2,6,6,7,7,11b-hexol (PubChem CID 135244012) has the molecular formula C19H29NO8 and a molecular weight of 399.44 g/mol. Its IUPAC name is 9,10-dimethoxy-3-(2-methylpropyl)-1,2,3,4-tetrahydrobenzo[a]quinolizine-2,6,6,7,7,11b-hexol.
| Compound Name | 9,10-dimethoxy-3-(2-methylpropyl)-1,2,3,4-tetrahydrobenzo[a]quinolizine-2,6,6,7,7,11b-hexol |
|---|---|
| PubChem CID | 135244012 |
| Molecular Formula | C19H29NO8 |
| Molecular Weight | 399.44 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | 9,10-dimethoxy-3-(2-methylpropyl)-1,2,3,4-tetrahydrobenzo[a]quinolizine-2,6,6,7,7,11b-hexol |
| SMILES | COc1cc2c(cc1OC)C(O)(O)C(O)(O)N1CC(CC(C)C)C(O)CC21O |
| InChI | InChI=1S/C19H29NO8/c1-10(2)5-11-9-20-17(22,8-14(11)21)12-6-15(27-3)16(28-4)7-13(12)18(23,24)19(20,25)26/h6-7,10-11,14,21-26H,5,8-9H2,1-4H3 |
| InChIKey | GPXSLUMNRAUDCU-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 143.08 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.44 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|