C27H41N3O3 — CID 135244152
tert-butyl N-[2-[10-hydroxy-2-methyl-15-(methylamino)-3-azapentacyclo[12.3.2.01,13.05,13.07,12]nonadeca-7(12),8,10-trien-3-yl]ethyl]carbamate (PubChem CID 135244152) has the molecular formula C27H41N3O3 and a molecular weight of 455.64 g/mol. Its IUPAC name is tert-butyl N-[2-[10-hydroxy-2-methyl-15-(methylamino)-3-azapentacyclo[12.3.2.01,13.05,13.07,12]nonadeca-7(12),8,10-trien-3-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[10-hydroxy-2-methyl-15-(methylamino)-3-azapentacyclo[12.3.2.01,13.05,13.07,12]nonadeca-7(12),8,10-trien-3-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 135244152 |
| Molecular Formula | C27H41N3O3 |
| Molecular Weight | 455.64 g/mol |
| Exact Mass | 455.31 |
| IUPAC Name | tert-butyl N-[2-[10-hydroxy-2-methyl-15-(methylamino)-3-azapentacyclo[12.3.2.01,13.05,13.07,12]nonadeca-7(12),8,10-trien-3-yl]ethyl]carbamate |
| SMILES | CNC1CCC23CCC1C21c2cc(O)ccc2CC1CN(CCNC(=O)OC(C)(C)C)C3C |
| InChI | InChI=1S/C27H41N3O3/c1-17-26-10-8-21(23(28-5)9-11-26)27(26)19(14-18-6-7-20(31)15-22(18)27)16-30(17)13-12-29-24(32)33-25(2,3)4/h6-7,15,17,19,21,23,28,31H,8-14,16H2,1-5H3,(H,29,32) |
| InChIKey | YGLGFNAISJMPJB-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.64 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |