About 6-[(3,4-dichlorophenoxy)methyl]-5-methyl-N-methylsulfanyl-1,2-benzoxazol-3-amine
6-[(3,4-dichlorophenoxy)methyl]-5-methyl-N-methylsulfanyl-1,2-benzoxazol-3-amine (PubChem CID 135244201) has the molecular formula C16H14Cl2N2O2S
and a molecular weight of 369.27 g/mol. Its IUPAC name is 6-[(3,4-dichlorophenoxy)methyl]-5-methyl-N-methylsulfanyl-1,2-benzoxazol-3-amine.
Molecular Properties
| Compound Name | 6-[(3,4-dichlorophenoxy)methyl]-5-methyl-N-methylsulfanyl-1,2-benzoxazol-3-amine |
| PubChem CID | 135244201 |
| Molecular Formula | C16H14Cl2N2O2S |
| Molecular Weight | 369.27 g/mol |
| Exact Mass | 368.02 |
| IUPAC Name | 6-[(3,4-dichlorophenoxy)methyl]-5-methyl-N-methylsulfanyl-1,2-benzoxazol-3-amine |
| SMILES | CSNc1noc2cc(COc3ccc(Cl)c(Cl)c3)c(C)cc12 |
| InChI | InChI=1S/C16H14Cl2N2O2S/c1-9-5-12-15(22-19-16(12)20-23-2)6-10(9)8-21-11-3-4-13(17)14(18)7-11/h3-7H,8H2,1-2H3,(H,19,20) |
| InChIKey | XMSBPHCMXOMNGW-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 369.27 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-[(3,4-dichlorophenoxy)methyl]-5-methyl-N-methylsulfanyl-1,2-benzoxazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(3,4-dichlorophenoxy)methyl]-5-methyl-N-methylsulfanyl-1,2-benzoxazol-3-amine?
The IUPAC name of 6-[(3,4-dichlorophenoxy)methyl]-5-methyl-N-methylsulfanyl-1,2-benzoxazol-3-amine (CID 135244201) is 6-[(3,4-dichlorophenoxy)methyl]-5-methyl-N-methylsulfanyl-1,2-benzoxazol-3-amine.
What is the SMILES notation for 6-[(3,4-dichlorophenoxy)methyl]-5-methyl-N-methylsulfanyl-1,2-benzoxazol-3-amine?
The canonical SMILES for 6-[(3,4-dichlorophenoxy)methyl]-5-methyl-N-methylsulfanyl-1,2-benzoxazol-3-amine is CSNc1noc2cc(COc3ccc(Cl)c(Cl)c3)c(C)cc12.
What is the InChIKey of 6-[(3,4-dichlorophenoxy)methyl]-5-methyl-N-methylsulfanyl-1,2-benzoxazol-3-amine?
The InChIKey is XMSBPHCMXOMNGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14Cl2N2O2S/c1-9-5-12-15(22-19-16(12)20-23-2)6-10(9)8-21-11-3-4-13(17)14(18)7-11/h3-7H,8H2,1-2H3,(H,19,20).
What are the key properties of 6-[(3,4-dichlorophenoxy)methyl]-5-methyl-N-methylsulfanyl-1,2-benzoxazol-3-amine?
6-[(3,4-dichlorophenoxy)methyl]-5-methyl-N-methylsulfanyl-1,2-benzoxazol-3-amine has a molecular weight of 369.27 g/mol, XLogP of 5.71, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(3,4-dichlorophenoxy)methyl]-5-methyl-N-methylsulfanyl-1,2-benzoxazol-3-amine is sourced from PubChem (CID 135244201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).