C13H26FN — CID 135244556
(E)-4-fluoro-2,2,3,5,6-pentamethyloct-6-en-1-amine (PubChem CID 135244556) has the molecular formula C13H26FN and a molecular weight of 215.36 g/mol. Its IUPAC name is (E)-4-fluoro-2,2,3,5,6-pentamethyloct-6-en-1-amine.
| Compound Name | (E)-4-fluoro-2,2,3,5,6-pentamethyloct-6-en-1-amine |
|---|---|
| PubChem CID | 135244556 |
| Molecular Formula | C13H26FN |
| Molecular Weight | 215.36 g/mol |
| Exact Mass | 215.20 |
| IUPAC Name | (E)-4-fluoro-2,2,3,5,6-pentamethyloct-6-en-1-amine |
| SMILES | C/C=C(\C)C(C)C(F)C(C)C(C)(C)CN |
| InChI | InChI=1S/C13H26FN/c1-7-9(2)10(3)12(14)11(4)13(5,6)8-15/h7,10-12H,8,15H2,1-6H3/b9-7+ |
| InChIKey | WRDZKWPAYVQTKD-VQHVLOKHSA-N |
| XLogP | 3.55 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.36 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|