C8H14FN — CID 135244622
3-fluoro-5-propyl-1,2,3,4-tetrahydropyridine (PubChem CID 135244622) has the molecular formula C8H14FN and a molecular weight of 143.20 g/mol. Its IUPAC name is 3-fluoro-5-propyl-1,2,3,4-tetrahydropyridine.
| Compound Name | 3-fluoro-5-propyl-1,2,3,4-tetrahydropyridine |
|---|---|
| PubChem CID | 135244622 |
| Molecular Formula | C8H14FN |
| Molecular Weight | 143.20 g/mol |
| Exact Mass | 143.11 |
| IUPAC Name | 3-fluoro-5-propyl-1,2,3,4-tetrahydropyridine |
| SMILES | CCCC1=CNCC(F)C1 |
| InChI | InChI=1S/C8H14FN/c1-2-3-7-4-8(9)6-10-5-7/h5,8,10H,2-4,6H2,1H3 |
| InChIKey | YPWLXRCMOOFPMU-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.20 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |