C12H17NO4 — CID 135244700
N-[(2Z,3Z)-5-methoxy-2-(1-methoxyethylidene)hexa-3,5-dienyl]-2-oxoacetamide (PubChem CID 135244700) has the molecular formula C12H17NO4 and a molecular weight of 239.27 g/mol. Its IUPAC name is N-[(2Z,3Z)-5-methoxy-2-(1-methoxyethylidene)hexa-3,5-dienyl]-2-oxoacetamide.
| Compound Name | N-[(2Z,3Z)-5-methoxy-2-(1-methoxyethylidene)hexa-3,5-dienyl]-2-oxoacetamide |
|---|---|
| PubChem CID | 135244700 |
| Molecular Formula | C12H17NO4 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | N-[(2Z,3Z)-5-methoxy-2-(1-methoxyethylidene)hexa-3,5-dienyl]-2-oxoacetamide |
| SMILES | C=C(/C=C\C(CNC(=O)C=O)=C(/C)OC)OC |
| InChI | InChI=1S/C12H17NO4/c1-9(16-3)5-6-11(10(2)17-4)7-13-12(15)8-14/h5-6,8H,1,7H2,2-4H3,(H,13,15)/b6-5-,11-10- |
| InChIKey | GDGBQSHPEHFREJ-VIFBMRGNSA-N |
| XLogP | 0.94 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|