About 8-hydroxy-7-phenyltricyclo[4.3.0.03,9]nonan-4-one
8-hydroxy-7-phenyltricyclo[4.3.0.03,9]nonan-4-one (PubChem CID 135244749) has the molecular formula C15H16O2
and a molecular weight of 228.29 g/mol. Its IUPAC name is 8-hydroxy-7-phenyltricyclo[4.3.0.03,9]nonan-4-one.
Molecular Properties
| Compound Name | 8-hydroxy-7-phenyltricyclo[4.3.0.03,9]nonan-4-one |
| PubChem CID | 135244749 |
| Molecular Formula | C15H16O2 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | 8-hydroxy-7-phenyltricyclo[4.3.0.03,9]nonan-4-one |
| SMILES | O=C1CC2C3CC1C3C(O)C2c1ccccc1 |
| InChI | InChI=1S/C15H16O2/c16-12-7-10-9-6-11(12)14(9)15(17)13(10)8-4-2-1-3-5-8/h1-5,9-11,13-15,17H,6-7H2 |
| InChIKey | BDYSDZLEJYHPHS-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-hydroxy-7-phenyltricyclo[4.3.0.03,9]nonan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-hydroxy-7-phenyltricyclo[4.3.0.03,9]nonan-4-one?
The IUPAC name of 8-hydroxy-7-phenyltricyclo[4.3.0.03,9]nonan-4-one (CID 135244749) is 8-hydroxy-7-phenyltricyclo[4.3.0.03,9]nonan-4-one.
What is the SMILES notation for 8-hydroxy-7-phenyltricyclo[4.3.0.03,9]nonan-4-one?
The canonical SMILES for 8-hydroxy-7-phenyltricyclo[4.3.0.03,9]nonan-4-one is O=C1CC2C3CC1C3C(O)C2c1ccccc1.
What is the InChIKey of 8-hydroxy-7-phenyltricyclo[4.3.0.03,9]nonan-4-one?
The InChIKey is BDYSDZLEJYHPHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16O2/c16-12-7-10-9-6-11(12)14(9)15(17)13(10)8-4-2-1-3-5-8/h1-5,9-11,13-15,17H,6-7H2.
What are the key properties of 8-hydroxy-7-phenyltricyclo[4.3.0.03,9]nonan-4-one?
8-hydroxy-7-phenyltricyclo[4.3.0.03,9]nonan-4-one has a molecular weight of 228.29 g/mol, XLogP of 1.99, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-hydroxy-7-phenyltricyclo[4.3.0.03,9]nonan-4-one is sourced from PubChem (CID 135244749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).