C46H40N2 — CID 135244840
9-but-3-ynyl-7-N-(5,5-dimethylcyclohepta-1,3,6-trien-1-yl)-10-methyl-2-N,2-N,7-N-triphenylphenanthrene-2,7-diamine (PubChem CID 135244840) has the molecular formula C46H40N2 and a molecular weight of 620.84 g/mol. Its IUPAC name is 9-but-3-ynyl-7-N-(5,5-dimethylcyclohepta-1,3,6-trien-1-yl)-10-methyl-2-N,2-N,7-N-triphenylphenanthrene-2,7-diamine.
| Compound Name | 9-but-3-ynyl-7-N-(5,5-dimethylcyclohepta-1,3,6-trien-1-yl)-10-methyl-2-N,2-N,7-N-triphenylphenanthrene-2,7-diamine |
|---|---|
| PubChem CID | 135244840 |
| Molecular Formula | C46H40N2 |
| Molecular Weight | 620.84 g/mol |
| Exact Mass | 620.32 |
| IUPAC Name | 9-but-3-ynyl-7-N-(5,5-dimethylcyclohepta-1,3,6-trien-1-yl)-10-methyl-2-N,2-N,7-N-triphenylphenanthrene-2,7-diamine |
| SMILES | C#CCCc1c(C)c2cc(N(c3ccccc3)c3ccccc3)ccc2c2ccc(N(C3=CC=CC(C)(C)C=C3)c3ccccc3)cc12 |
| InChI | InChI=1S/C46H40N2/c1-5-6-24-41-34(2)44-32-39(47(35-17-10-7-11-18-35)36-19-12-8-13-20-36)25-27-42(44)43-28-26-40(33-45(41)43)48(37-21-14-9-15-22-37)38-23-16-30-46(3,4)31-29-38/h1,7-23,25-33H,6,24H2,2-4H3 |
| InChIKey | PGTWMRBBNHIXCD-UHFFFAOYSA-N |
| XLogP | 12.51 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.84 |
| LogP ≤ 5 | 12.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|