About 3-[(4R)-6,8-dichloro-2-ethyl-3,4-dihydro-1H-isoquinolin-4-yl]benzenesulfonyl chloride
3-[(4R)-6,8-dichloro-2-ethyl-3,4-dihydro-1H-isoquinolin-4-yl]benzenesulfonyl chloride (PubChem CID 135245016) has the molecular formula C17H16Cl3NO2S
and a molecular weight of 404.75 g/mol. Its IUPAC name is 3-[(4R)-6,8-dichloro-2-ethyl-3,4-dihydro-1H-isoquinolin-4-yl]benzenesulfonyl chloride.
Molecular Properties
| Compound Name | 3-[(4R)-6,8-dichloro-2-ethyl-3,4-dihydro-1H-isoquinolin-4-yl]benzenesulfonyl chloride |
| PubChem CID | 135245016 |
| Molecular Formula | C17H16Cl3NO2S |
| Molecular Weight | 404.75 g/mol |
| Exact Mass | 403.00 |
| IUPAC Name | 3-[(4R)-6,8-dichloro-2-ethyl-3,4-dihydro-1H-isoquinolin-4-yl]benzenesulfonyl chloride |
| SMILES | CCN1Cc2c(Cl)cc(Cl)cc2[C@@H](c2cccc(S(=O)(=O)Cl)c2)C1 |
| InChI | InChI=1S/C17H16Cl3NO2S/c1-2-21-9-15(11-4-3-5-13(6-11)24(20,22)23)14-7-12(18)8-17(19)16(14)10-21/h3-8,15H,2,9-10H2,1H3/t15-/m1/s1 |
| InChIKey | UBHGGKZRYVJYOI-OAHLLOKOSA-N |
| XLogP | 4.89 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.75 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(4R)-6,8-dichloro-2-ethyl-3,4-dihydro-1H-isoquinolin-4-yl]benzenesulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4R)-6,8-dichloro-2-ethyl-3,4-dihydro-1H-isoquinolin-4-yl]benzenesulfonyl chloride?
The IUPAC name of 3-[(4R)-6,8-dichloro-2-ethyl-3,4-dihydro-1H-isoquinolin-4-yl]benzenesulfonyl chloride (CID 135245016) is 3-[(4R)-6,8-dichloro-2-ethyl-3,4-dihydro-1H-isoquinolin-4-yl]benzenesulfonyl chloride.
What is the SMILES notation for 3-[(4R)-6,8-dichloro-2-ethyl-3,4-dihydro-1H-isoquinolin-4-yl]benzenesulfonyl chloride?
The canonical SMILES for 3-[(4R)-6,8-dichloro-2-ethyl-3,4-dihydro-1H-isoquinolin-4-yl]benzenesulfonyl chloride is CCN1Cc2c(Cl)cc(Cl)cc2[C@@H](c2cccc(S(=O)(=O)Cl)c2)C1.
What is the InChIKey of 3-[(4R)-6,8-dichloro-2-ethyl-3,4-dihydro-1H-isoquinolin-4-yl]benzenesulfonyl chloride?
The InChIKey is UBHGGKZRYVJYOI-OAHLLOKOSA-N. The full InChI is InChI=1S/C17H16Cl3NO2S/c1-2-21-9-15(11-4-3-5-13(6-11)24(20,22)23)14-7-12(18)8-17(19)16(14)10-21/h3-8,15H,2,9-10H2,1H3/t15-/m1/s1.
What are the key properties of 3-[(4R)-6,8-dichloro-2-ethyl-3,4-dihydro-1H-isoquinolin-4-yl]benzenesulfonyl chloride?
3-[(4R)-6,8-dichloro-2-ethyl-3,4-dihydro-1H-isoquinolin-4-yl]benzenesulfonyl chloride has a molecular weight of 404.75 g/mol, XLogP of 4.89, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4R)-6,8-dichloro-2-ethyl-3,4-dihydro-1H-isoquinolin-4-yl]benzenesulfonyl chloride is sourced from PubChem (CID 135245016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).