About 9-ethenylpyrido[1,2-a]pyrimidin-4-one
9-ethenylpyrido[1,2-a]pyrimidin-4-one (PubChem CID 135245055) has the molecular formula C10H8N2O
and a molecular weight of 172.19 g/mol. Its IUPAC name is 9-ethenylpyrido[1,2-a]pyrimidin-4-one.
Molecular Properties
| Compound Name | 9-ethenylpyrido[1,2-a]pyrimidin-4-one |
| PubChem CID | 135245055 |
| Molecular Formula | C10H8N2O |
| Molecular Weight | 172.19 g/mol |
| Exact Mass | 172.06 |
| IUPAC Name | 9-ethenylpyrido[1,2-a]pyrimidin-4-one |
| SMILES | C=Cc1cccn2c(=O)ccnc12 |
| InChI | InChI=1S/C10H8N2O/c1-2-8-4-3-7-12-9(13)5-6-11-10(8)12/h2-7H,1H2 |
| InChIKey | WZRLXMIXIHYYKV-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.19 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 9-ethenylpyrido[1,2-a]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-ethenylpyrido[1,2-a]pyrimidin-4-one?
The IUPAC name of 9-ethenylpyrido[1,2-a]pyrimidin-4-one (CID 135245055) is 9-ethenylpyrido[1,2-a]pyrimidin-4-one.
What is the SMILES notation for 9-ethenylpyrido[1,2-a]pyrimidin-4-one?
The canonical SMILES for 9-ethenylpyrido[1,2-a]pyrimidin-4-one is C=Cc1cccn2c(=O)ccnc12.
What is the InChIKey of 9-ethenylpyrido[1,2-a]pyrimidin-4-one?
The InChIKey is WZRLXMIXIHYYKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O/c1-2-8-4-3-7-12-9(13)5-6-11-10(8)12/h2-7H,1H2.
What are the key properties of 9-ethenylpyrido[1,2-a]pyrimidin-4-one?
9-ethenylpyrido[1,2-a]pyrimidin-4-one has a molecular weight of 172.19 g/mol, XLogP of 1.34, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-ethenylpyrido[1,2-a]pyrimidin-4-one is sourced from PubChem (CID 135245055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).