C55H35N5 — CID 135245605
2-[10-[4-(4-naphthalen-1-yl-6-phenylpyrimidin-2-yl)phenyl]phenanthren-9-yl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 135245605) has the molecular formula C55H35N5 and a molecular weight of 765.92 g/mol. Its IUPAC name is 2-[10-[4-(4-naphthalen-1-yl-6-phenylpyrimidin-2-yl)phenyl]phenanthren-9-yl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[10-[4-(4-naphthalen-1-yl-6-phenylpyrimidin-2-yl)phenyl]phenanthren-9-yl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 135245605 |
| Molecular Formula | C55H35N5 |
| Molecular Weight | 765.92 g/mol |
| Exact Mass | 765.29 |
| IUPAC Name | 2-[10-[4-(4-naphthalen-1-yl-6-phenylpyrimidin-2-yl)phenyl]phenanthren-9-yl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | c1ccc(-c2cc(-c3cccc4ccccc34)nc(-c3ccc(-c4c(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)c5ccccc5c5ccccc45)cc3)n2)cc1 |
| InChI | InChI=1S/C55H35N5/c1-4-18-37(19-5-1)48-35-49(45-30-16-24-36-17-10-11-25-42(36)45)57-52(56-48)41-33-31-38(32-34-41)50-46-28-14-12-26-43(46)44-27-13-15-29-47(44)51(50)55-59-53(39-20-6-2-7-21-39)58-54(60-55)40-22-8-3-9-23-40/h1-35H |
| InChIKey | DQJNCHBABDNJOK-UHFFFAOYSA-N |
| XLogP | 13.79 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.92 |
| LogP ≤ 5 | 13.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|