About (3Z)-7-fluoro-2,3-dimethyl-4-(methylamino)octa-3,5-dien-2-ol
(3Z)-7-fluoro-2,3-dimethyl-4-(methylamino)octa-3,5-dien-2-ol (PubChem CID 135245737) has the molecular formula C11H20FNO
and a molecular weight of 201.28 g/mol. Its IUPAC name is (3Z)-7-fluoro-2,3-dimethyl-4-(methylamino)octa-3,5-dien-2-ol.
Molecular Properties
| Compound Name | (3Z)-7-fluoro-2,3-dimethyl-4-(methylamino)octa-3,5-dien-2-ol |
| PubChem CID | 135245737 |
| Molecular Formula | C11H20FNO |
| Molecular Weight | 201.28 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | (3Z)-7-fluoro-2,3-dimethyl-4-(methylamino)octa-3,5-dien-2-ol |
| SMILES | CN/C(C=CC(C)F)=C(/C)C(C)(C)O |
| InChI | InChI=1S/C11H20FNO/c1-8(12)6-7-10(13-5)9(2)11(3,4)14/h6-8,13-14H,1-5H3/b7-6?,10-9- |
| InChIKey | QRSGIGVZFAGAEQ-CZTAHCJSSA-N |
| XLogP | 2.16 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.28 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-7-fluoro-2,3-dimethyl-4-(methylamino)octa-3,5-dien-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-7-fluoro-2,3-dimethyl-4-(methylamino)octa-3,5-dien-2-ol?
The IUPAC name of (3Z)-7-fluoro-2,3-dimethyl-4-(methylamino)octa-3,5-dien-2-ol (CID 135245737) is (3Z)-7-fluoro-2,3-dimethyl-4-(methylamino)octa-3,5-dien-2-ol.
What is the SMILES notation for (3Z)-7-fluoro-2,3-dimethyl-4-(methylamino)octa-3,5-dien-2-ol?
The canonical SMILES for (3Z)-7-fluoro-2,3-dimethyl-4-(methylamino)octa-3,5-dien-2-ol is CN/C(C=CC(C)F)=C(/C)C(C)(C)O.
What is the InChIKey of (3Z)-7-fluoro-2,3-dimethyl-4-(methylamino)octa-3,5-dien-2-ol?
The InChIKey is QRSGIGVZFAGAEQ-CZTAHCJSSA-N. The full InChI is InChI=1S/C11H20FNO/c1-8(12)6-7-10(13-5)9(2)11(3,4)14/h6-8,13-14H,1-5H3/b7-6?,10-9-.
What are the key properties of (3Z)-7-fluoro-2,3-dimethyl-4-(methylamino)octa-3,5-dien-2-ol?
(3Z)-7-fluoro-2,3-dimethyl-4-(methylamino)octa-3,5-dien-2-ol has a molecular weight of 201.28 g/mol, XLogP of 2.16, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-7-fluoro-2,3-dimethyl-4-(methylamino)octa-3,5-dien-2-ol is sourced from PubChem (CID 135245737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).