C17H21F4N5O — CID 135245877
N,N'-diamino-N-[3,3-difluoro-2-[4-fluoro-2-(fluoromethyl)cyclohexa-1,3-dien-1-yl]-2-hydroxy-3-(5-methyl-2-pyridinyl)propyl]methanimidamide (PubChem CID 135245877) has the molecular formula C17H21F4N5O and a molecular weight of 387.38 g/mol. Its IUPAC name is N,N'-diamino-N-[3,3-difluoro-2-[4-fluoro-2-(fluoromethyl)cyclohexa-1,3-dien-1-yl]-2-hydroxy-3-(5-methyl-2-pyridinyl)propyl]methanimidamide.
| Compound Name | N,N'-diamino-N-[3,3-difluoro-2-[4-fluoro-2-(fluoromethyl)cyclohexa-1,3-dien-1-yl]-2-hydroxy-3-(5-methyl-2-pyridinyl)propyl]methanimidamide |
|---|---|
| PubChem CID | 135245877 |
| Molecular Formula | C17H21F4N5O |
| Molecular Weight | 387.38 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | N,N'-diamino-N-[3,3-difluoro-2-[4-fluoro-2-(fluoromethyl)cyclohexa-1,3-dien-1-yl]-2-hydroxy-3-(5-methyl-2-pyridinyl)propyl]methanimidamide |
| SMILES | Cc1ccc(C(F)(F)C(O)(CN(N)/C=N\N)C2=C(CF)C=C(F)CC2)nc1 |
| InChI | InChI=1S/C17H21F4N5O/c1-11-2-5-15(24-8-11)17(20,21)16(27,9-26(23)10-25-22)14-4-3-13(19)6-12(14)7-18/h2,5-6,8,10,27H,3-4,7,9,22-23H2,1H3/b25-10- |
| InChIKey | YEJGKGZSQNWCON-MRUKODCESA-N |
| XLogP | 2.20 |
| TPSA | 100.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.38 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|