C23H22FN7O — CID 135245914
(Z)-2-(N-amino-2-fluoroanilino)-1-[3-[4-(methylaminomethyl)phenyl]-1,2,4-oxadiazol-5-yl]-2-pyridin-4-ylethenamine (PubChem CID 135245914) has the molecular formula C23H22FN7O and a molecular weight of 431.48 g/mol. Its IUPAC name is (Z)-2-(N-amino-2-fluoroanilino)-1-[3-[4-(methylaminomethyl)phenyl]-1,2,4-oxadiazol-5-yl]-2-pyridin-4-ylethenamine.
| Compound Name | (Z)-2-(N-amino-2-fluoroanilino)-1-[3-[4-(methylaminomethyl)phenyl]-1,2,4-oxadiazol-5-yl]-2-pyridin-4-ylethenamine |
|---|---|
| PubChem CID | 135245914 |
| Molecular Formula | C23H22FN7O |
| Molecular Weight | 431.48 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | (Z)-2-(N-amino-2-fluoroanilino)-1-[3-[4-(methylaminomethyl)phenyl]-1,2,4-oxadiazol-5-yl]-2-pyridin-4-ylethenamine |
| SMILES | CNCc1ccc(-c2noc(/C(N)=C(\c3ccncc3)N(N)c3ccccc3F)n2)cc1 |
| InChI | InChI=1S/C23H22FN7O/c1-27-14-15-6-8-17(9-7-15)22-29-23(32-30-22)20(25)21(16-10-12-28-13-11-16)31(26)19-5-3-2-4-18(19)24/h2-13,27H,14,25-26H2,1H3/b21-20- |
| InChIKey | XNLKERROZYGUMA-MRCUWXFGSA-N |
| XLogP | 3.15 |
| TPSA | 119.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.48 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|