C21H15F3N6O — CID 135245945
(Z)-2-(N-amino-2-fluoroanilino)-1-[3-(2,6-difluorophenyl)-1,2,4-oxadiazol-5-yl]-2-pyridin-4-ylethenamine (PubChem CID 135245945) has the molecular formula C21H15F3N6O and a molecular weight of 424.39 g/mol. Its IUPAC name is (Z)-2-(N-amino-2-fluoroanilino)-1-[3-(2,6-difluorophenyl)-1,2,4-oxadiazol-5-yl]-2-pyridin-4-ylethenamine.
| Compound Name | (Z)-2-(N-amino-2-fluoroanilino)-1-[3-(2,6-difluorophenyl)-1,2,4-oxadiazol-5-yl]-2-pyridin-4-ylethenamine |
|---|---|
| PubChem CID | 135245945 |
| Molecular Formula | C21H15F3N6O |
| Molecular Weight | 424.39 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | (Z)-2-(N-amino-2-fluoroanilino)-1-[3-(2,6-difluorophenyl)-1,2,4-oxadiazol-5-yl]-2-pyridin-4-ylethenamine |
| SMILES | N/C(=C(/c1ccncc1)N(N)c1ccccc1F)c1nc(-c2c(F)cccc2F)no1 |
| InChI | InChI=1S/C21H15F3N6O/c22-13-4-1-2-7-16(13)30(26)19(12-8-10-27-11-9-12)18(25)21-28-20(29-31-21)17-14(23)5-3-6-15(17)24/h1-11H,25-26H2/b19-18- |
| InChIKey | WJUODZAUSFVHPC-HNENSFHCSA-N |
| XLogP | 3.71 |
| TPSA | 107.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.39 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|