C28H31FN8O2S — CID 135245991
N-[1-[[4-[5-[(Z)-1-amino-2-(N-amino-2-fluoroanilino)-2-pyridin-4-ylethenyl]-1,2,4-oxadiazol-3-yl]phenyl]methyl]piperidin-4-yl]methanesulfinamide (PubChem CID 135245991) has the molecular formula C28H31FN8O2S and a molecular weight of 562.68 g/mol. Its IUPAC name is N-[1-[[4-[5-[(Z)-1-amino-2-(N-amino-2-fluoroanilino)-2-pyridin-4-ylethenyl]-1,2,4-oxadiazol-3-yl]phenyl]methyl]piperidin-4-yl]methanesulfinamide.
| Compound Name | N-[1-[[4-[5-[(Z)-1-amino-2-(N-amino-2-fluoroanilino)-2-pyridin-4-ylethenyl]-1,2,4-oxadiazol-3-yl]phenyl]methyl]piperidin-4-yl]methanesulfinamide |
|---|---|
| PubChem CID | 135245991 |
| Molecular Formula | C28H31FN8O2S |
| Molecular Weight | 562.68 g/mol |
| Exact Mass | 562.23 |
| IUPAC Name | N-[1-[[4-[5-[(Z)-1-amino-2-(N-amino-2-fluoroanilino)-2-pyridin-4-ylethenyl]-1,2,4-oxadiazol-3-yl]phenyl]methyl]piperidin-4-yl]methanesulfinamide |
| SMILES | CS(=O)NC1CCN(Cc2ccc(-c3noc(/C(N)=C(\c4ccncc4)N(N)c4ccccc4F)n3)cc2)CC1 |
| InChI | InChI=1S/C28H31FN8O2S/c1-40(38)35-22-12-16-36(17-13-22)18-19-6-8-21(9-7-19)27-33-28(39-34-27)25(30)26(20-10-14-32-15-11-20)37(31)24-5-3-2-4-23(24)29/h2-11,14-15,22,35H,12-13,16-18,30-31H2,1H3/b26-25- |
| InChIKey | UDPVRLBJVKQSMF-QPLCGJKRSA-N |
| XLogP | 3.28 |
| TPSA | 139.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.68 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|