About 5,7-dimethyl-3,7-dihydrocyclohepta[d]imidazole
5,7-dimethyl-3,7-dihydrocyclohepta[d]imidazole (PubChem CID 135246009) has the molecular formula C10H12N2
and a molecular weight of 160.22 g/mol. Its IUPAC name is 5,7-dimethyl-3,7-dihydrocyclohepta[d]imidazole.
Molecular Properties
| Compound Name | 5,7-dimethyl-3,7-dihydrocyclohepta[d]imidazole |
| PubChem CID | 135246009 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | 5,7-dimethyl-3,7-dihydrocyclohepta[d]imidazole |
| SMILES | CC1=CC(C)C=c2nc[nH]c2=C1 |
| InChI | InChI=1S/C10H12N2/c1-7-3-8(2)5-10-9(4-7)11-6-12-10/h3-7H,1-2H3,(H,11,12) |
| InChIKey | FZUWJVHSMRHBDW-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5,7-dimethyl-3,7-dihydrocyclohepta[d]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-dimethyl-3,7-dihydrocyclohepta[d]imidazole?
The IUPAC name of 5,7-dimethyl-3,7-dihydrocyclohepta[d]imidazole (CID 135246009) is 5,7-dimethyl-3,7-dihydrocyclohepta[d]imidazole.
What is the SMILES notation for 5,7-dimethyl-3,7-dihydrocyclohepta[d]imidazole?
The canonical SMILES for 5,7-dimethyl-3,7-dihydrocyclohepta[d]imidazole is CC1=CC(C)C=c2nc[nH]c2=C1.
What is the InChIKey of 5,7-dimethyl-3,7-dihydrocyclohepta[d]imidazole?
The InChIKey is FZUWJVHSMRHBDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2/c1-7-3-8(2)5-10-9(4-7)11-6-12-10/h3-7H,1-2H3,(H,11,12).
What are the key properties of 5,7-dimethyl-3,7-dihydrocyclohepta[d]imidazole?
5,7-dimethyl-3,7-dihydrocyclohepta[d]imidazole has a molecular weight of 160.22 g/mol, XLogP of 0.57, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dimethyl-3,7-dihydrocyclohepta[d]imidazole is sourced from PubChem (CID 135246009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).