C17H13F2N5O — CID 135246037
[(E)-1-[3-(2,5-difluorophenyl)-1,2,4-oxadiazol-5-yl]-2-pyridin-2-ylprop-1-enyl]-methyldiazene (PubChem CID 135246037) has the molecular formula C17H13F2N5O and a molecular weight of 341.32 g/mol. Its IUPAC name is [(E)-1-[3-(2,5-difluorophenyl)-1,2,4-oxadiazol-5-yl]-2-pyridin-2-ylprop-1-enyl]-methyldiazene.
| Compound Name | [(E)-1-[3-(2,5-difluorophenyl)-1,2,4-oxadiazol-5-yl]-2-pyridin-2-ylprop-1-enyl]-methyldiazene |
|---|---|
| PubChem CID | 135246037 |
| Molecular Formula | C17H13F2N5O |
| Molecular Weight | 341.32 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | [(E)-1-[3-(2,5-difluorophenyl)-1,2,4-oxadiazol-5-yl]-2-pyridin-2-ylprop-1-enyl]-methyldiazene |
| SMILES | C/N=N/C(=C(\C)c1ccccn1)c1nc(-c2cc(F)ccc2F)no1 |
| InChI | InChI=1S/C17H13F2N5O/c1-10(14-5-3-4-8-21-14)15(23-20-2)17-22-16(24-25-17)12-9-11(18)6-7-13(12)19/h3-9H,1-2H3/b15-10+,23-20+ |
| InChIKey | YGWCMOGTLKHQTB-NSFTWKFUSA-N |
| XLogP | 4.38 |
| TPSA | 76.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.32 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|