C25H26FN7O2 — CID 135246135
(Z)-2-(N-amino-2-fluoroanilino)-1-[3-[4-[(2-methoxyethylamino)methyl]phenyl]-1,2,4-oxadiazol-5-yl]-2-pyridin-4-ylethenamine (PubChem CID 135246135) has the molecular formula C25H26FN7O2 and a molecular weight of 475.53 g/mol. Its IUPAC name is (Z)-2-(N-amino-2-fluoroanilino)-1-[3-[4-[(2-methoxyethylamino)methyl]phenyl]-1,2,4-oxadiazol-5-yl]-2-pyridin-4-ylethenamine.
| Compound Name | (Z)-2-(N-amino-2-fluoroanilino)-1-[3-[4-[(2-methoxyethylamino)methyl]phenyl]-1,2,4-oxadiazol-5-yl]-2-pyridin-4-ylethenamine |
|---|---|
| PubChem CID | 135246135 |
| Molecular Formula | C25H26FN7O2 |
| Molecular Weight | 475.53 g/mol |
| Exact Mass | 475.21 |
| IUPAC Name | (Z)-2-(N-amino-2-fluoroanilino)-1-[3-[4-[(2-methoxyethylamino)methyl]phenyl]-1,2,4-oxadiazol-5-yl]-2-pyridin-4-ylethenamine |
| SMILES | COCCNCc1ccc(-c2noc(/C(N)=C(\c3ccncc3)N(N)c3ccccc3F)n2)cc1 |
| InChI | InChI=1S/C25H26FN7O2/c1-34-15-14-30-16-17-6-8-19(9-7-17)24-31-25(35-32-24)22(27)23(18-10-12-29-13-11-18)33(28)21-5-3-2-4-20(21)26/h2-13,30H,14-16,27-28H2,1H3/b23-22- |
| InChIKey | JTEKWNPYWBBVAC-FCQUAONHSA-N |
| XLogP | 3.17 |
| TPSA | 128.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.53 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|