C6H10F3N3 — CID 135246402
(1E,3Z)-5,5,5-trifluoro-1-N'-methylpenta-1,3-diene-1,1,4-triamine (PubChem CID 135246402) has the molecular formula C6H10F3N3 and a molecular weight of 181.16 g/mol. Its IUPAC name is (1E,3Z)-5,5,5-trifluoro-1-N'-methylpenta-1,3-diene-1,1,4-triamine.
| Compound Name | (1E,3Z)-5,5,5-trifluoro-1-N'-methylpenta-1,3-diene-1,1,4-triamine |
|---|---|
| PubChem CID | 135246402 |
| Molecular Formula | C6H10F3N3 |
| Molecular Weight | 181.16 g/mol |
| Exact Mass | 181.08 |
| IUPAC Name | (1E,3Z)-5,5,5-trifluoro-1-N'-methylpenta-1,3-diene-1,1,4-triamine |
| SMILES | CN/C(N)=C/C=C(\N)C(F)(F)F |
| InChI | InChI=1S/C6H10F3N3/c1-12-5(11)3-2-4(10)6(7,8)9/h2-3,12H,10-11H2,1H3/b4-2-,5-3+ |
| InChIKey | HPBWIMFTRASFTL-VOERYJCWSA-N |
| XLogP | 0.41 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.16 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|