About 2-ethenyl-1,1,3-trimethyl-3-(2-methylpropyl)guanidine
2-ethenyl-1,1,3-trimethyl-3-(2-methylpropyl)guanidine (PubChem CID 135246482) has the molecular formula C10H21N3
and a molecular weight of 183.30 g/mol. Its IUPAC name is 2-ethenyl-1,1,3-trimethyl-3-(2-methylpropyl)guanidine.
Molecular Properties
| Compound Name | 2-ethenyl-1,1,3-trimethyl-3-(2-methylpropyl)guanidine |
| PubChem CID | 135246482 |
| Molecular Formula | C10H21N3 |
| Molecular Weight | 183.30 g/mol |
| Exact Mass | 183.17 |
| IUPAC Name | 2-ethenyl-1,1,3-trimethyl-3-(2-methylpropyl)guanidine |
| SMILES | C=C/N=C(\N(C)C)N(C)CC(C)C |
| InChI | InChI=1S/C10H21N3/c1-7-11-10(12(4)5)13(6)8-9(2)3/h7,9H,1,8H2,2-6H3/b11-10+ |
| InChIKey | MKABNMNNJAKHKD-ZHACJKMWSA-N |
| XLogP | 1.64 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.30 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-ethenyl-1,1,3-trimethyl-3-(2-methylpropyl)guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenyl-1,1,3-trimethyl-3-(2-methylpropyl)guanidine?
The IUPAC name of 2-ethenyl-1,1,3-trimethyl-3-(2-methylpropyl)guanidine (CID 135246482) is 2-ethenyl-1,1,3-trimethyl-3-(2-methylpropyl)guanidine.
What is the SMILES notation for 2-ethenyl-1,1,3-trimethyl-3-(2-methylpropyl)guanidine?
The canonical SMILES for 2-ethenyl-1,1,3-trimethyl-3-(2-methylpropyl)guanidine is C=C/N=C(\N(C)C)N(C)CC(C)C.
What is the InChIKey of 2-ethenyl-1,1,3-trimethyl-3-(2-methylpropyl)guanidine?
The InChIKey is MKABNMNNJAKHKD-ZHACJKMWSA-N. The full InChI is InChI=1S/C10H21N3/c1-7-11-10(12(4)5)13(6)8-9(2)3/h7,9H,1,8H2,2-6H3/b11-10+.
What are the key properties of 2-ethenyl-1,1,3-trimethyl-3-(2-methylpropyl)guanidine?
2-ethenyl-1,1,3-trimethyl-3-(2-methylpropyl)guanidine has a molecular weight of 183.30 g/mol, XLogP of 1.64, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenyl-1,1,3-trimethyl-3-(2-methylpropyl)guanidine is sourced from PubChem (CID 135246482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).