About 2-[2-[[6-(1,1-difluoroethyl)-3-pyridinyl]oxy]-3-pyridinyl]-3,6-diethylpyridine
2-[2-[[6-(1,1-difluoroethyl)-3-pyridinyl]oxy]-3-pyridinyl]-3,6-diethylpyridine (PubChem CID 135246520) has the molecular formula C21H21F2N3O
and a molecular weight of 369.42 g/mol. Its IUPAC name is 2-[2-[[6-(1,1-difluoroethyl)-3-pyridinyl]oxy]-3-pyridinyl]-3,6-diethylpyridine.
Molecular Properties
| Compound Name | 2-[2-[[6-(1,1-difluoroethyl)-3-pyridinyl]oxy]-3-pyridinyl]-3,6-diethylpyridine |
| PubChem CID | 135246520 |
| Molecular Formula | C21H21F2N3O |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 2-[2-[[6-(1,1-difluoroethyl)-3-pyridinyl]oxy]-3-pyridinyl]-3,6-diethylpyridine |
| SMILES | CCc1ccc(CC)c(-c2cccnc2Oc2ccc(C(C)(F)F)nc2)n1 |
| InChI | InChI=1S/C21H21F2N3O/c1-4-14-8-9-15(5-2)26-19(14)17-7-6-12-24-20(17)27-16-10-11-18(25-13-16)21(3,22)23/h6-13H,4-5H2,1-3H3 |
| InChIKey | LIUBDCLZGDNUFY-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[2-[[6-(1,1-difluoroethyl)-3-pyridinyl]oxy]-3-pyridinyl]-3,6-diethylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[[6-(1,1-difluoroethyl)-3-pyridinyl]oxy]-3-pyridinyl]-3,6-diethylpyridine?
The IUPAC name of 2-[2-[[6-(1,1-difluoroethyl)-3-pyridinyl]oxy]-3-pyridinyl]-3,6-diethylpyridine (CID 135246520) is 2-[2-[[6-(1,1-difluoroethyl)-3-pyridinyl]oxy]-3-pyridinyl]-3,6-diethylpyridine.
What is the SMILES notation for 2-[2-[[6-(1,1-difluoroethyl)-3-pyridinyl]oxy]-3-pyridinyl]-3,6-diethylpyridine?
The canonical SMILES for 2-[2-[[6-(1,1-difluoroethyl)-3-pyridinyl]oxy]-3-pyridinyl]-3,6-diethylpyridine is CCc1ccc(CC)c(-c2cccnc2Oc2ccc(C(C)(F)F)nc2)n1.
What is the InChIKey of 2-[2-[[6-(1,1-difluoroethyl)-3-pyridinyl]oxy]-3-pyridinyl]-3,6-diethylpyridine?
The InChIKey is LIUBDCLZGDNUFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21F2N3O/c1-4-14-8-9-15(5-2)26-19(14)17-7-6-12-24-20(17)27-16-10-11-18(25-13-16)21(3,22)23/h6-13H,4-5H2,1-3H3.
What are the key properties of 2-[2-[[6-(1,1-difluoroethyl)-3-pyridinyl]oxy]-3-pyridinyl]-3,6-diethylpyridine?
2-[2-[[6-(1,1-difluoroethyl)-3-pyridinyl]oxy]-3-pyridinyl]-3,6-diethylpyridine has a molecular weight of 369.42 g/mol, XLogP of 5.57, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[[6-(1,1-difluoroethyl)-3-pyridinyl]oxy]-3-pyridinyl]-3,6-diethylpyridine is sourced from PubChem (CID 135246520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).